About 3-ethyl-4,5-dimethyl-1H-imidazol-2-one
3-ethyl-4,5-dimethyl-1H-imidazol-2-one (PubChem CID 14896912) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 3-ethyl-4,5-dimethyl-1H-imidazol-2-one.
Molecular Properties
| Compound Name | 3-ethyl-4,5-dimethyl-1H-imidazol-2-one |
| PubChem CID | 14896912 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 3-ethyl-4,5-dimethyl-1H-imidazol-2-one |
| SMILES | CCn1c(C)c(C)[nH]c1=O |
| InChI | InChI=1S/C7H12N2O/c1-4-9-6(3)5(2)8-7(9)10/h4H2,1-3H3,(H,8,10) |
| InChIKey | PJHLWGZVVAXAQY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-4,5-dimethyl-1H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4,5-dimethyl-1H-imidazol-2-one?
The IUPAC name of 3-ethyl-4,5-dimethyl-1H-imidazol-2-one (CID 14896912) is 3-ethyl-4,5-dimethyl-1H-imidazol-2-one.
What is the SMILES notation for 3-ethyl-4,5-dimethyl-1H-imidazol-2-one?
The canonical SMILES for 3-ethyl-4,5-dimethyl-1H-imidazol-2-one is CCn1c(C)c(C)[nH]c1=O.
What is the InChIKey of 3-ethyl-4,5-dimethyl-1H-imidazol-2-one?
The InChIKey is PJHLWGZVVAXAQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-4-9-6(3)5(2)8-7(9)10/h4H2,1-3H3,(H,8,10).
What are the key properties of 3-ethyl-4,5-dimethyl-1H-imidazol-2-one?
3-ethyl-4,5-dimethyl-1H-imidazol-2-one has a molecular weight of 140.19 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,5-dimethyl-1H-imidazol-2-one is sourced from PubChem (CID 14896912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).