C22H24F3IO2 — CID 148970306
1,1,1-trifluoro-3-[1-[4-(1-iodoethenyl)naphthalen-1-yl]cyclopentyl]oxy-2-methylbutan-2-ol (PubChem CID 148970306) has the molecular formula C22H24F3IO2 and a molecular weight of 504.33 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[1-[4-(1-iodoethenyl)naphthalen-1-yl]cyclopentyl]oxy-2-methylbutan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[1-[4-(1-iodoethenyl)naphthalen-1-yl]cyclopentyl]oxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 148970306 |
| Molecular Formula | C22H24F3IO2 |
| Molecular Weight | 504.33 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 1,1,1-trifluoro-3-[1-[4-(1-iodoethenyl)naphthalen-1-yl]cyclopentyl]oxy-2-methylbutan-2-ol |
| SMILES | C=C(I)c1ccc(C2(OC(C)C(C)(O)C(F)(F)F)CCCC2)c2ccccc12 |
| InChI | InChI=1S/C22H24F3IO2/c1-14(26)16-10-11-19(18-9-5-4-8-17(16)18)21(12-6-7-13-21)28-15(2)20(3,27)22(23,24)25/h4-5,8-11,15,27H,1,6-7,12-13H2,2-3H3 |
| InChIKey | PTSRFACPVPDRKK-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.33 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|