About N'-methoxyethanimidamide
N'-methoxyethanimidamide (PubChem CID 14897264) has the molecular formula C3H8N2O
and a molecular weight of 88.11 g/mol. Its IUPAC name is N'-methoxyethanimidamide.
Molecular Properties
| Compound Name | N'-methoxyethanimidamide |
| PubChem CID | 14897264 |
| Molecular Formula | C3H8N2O |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.06 |
| IUPAC Name | N'-methoxyethanimidamide |
| SMILES | CO/N=C(/C)N |
| InChI | InChI=1S/C3H8N2O/c1-3(4)5-6-2/h1-2H3,(H2,4,5) |
| InChIKey | WMWMBQUGRILRBV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-methoxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methoxyethanimidamide?
The IUPAC name of N'-methoxyethanimidamide (CID 14897264) is N'-methoxyethanimidamide.
What is the SMILES notation for N'-methoxyethanimidamide?
The canonical SMILES for N'-methoxyethanimidamide is CO/N=C(/C)N.
What is the InChIKey of N'-methoxyethanimidamide?
The InChIKey is WMWMBQUGRILRBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O/c1-3(4)5-6-2/h1-2H3,(H2,4,5).
What are the key properties of N'-methoxyethanimidamide?
N'-methoxyethanimidamide has a molecular weight of 88.11 g/mol, XLogP of -0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methoxyethanimidamide is sourced from PubChem (CID 14897264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).