C27H41F2N2O8S4+ — CID 148975492
[3-[2-cyclohexyl-5-[2-(3-ethylsulfonyl-1,3-thiazolidin-1-ium-1-yl)-2-methylpropanoyl]phenyl]piperidin-1-yl]sulfonyl-difluoromethanesulfonic acid (PubChem CID 148975492) has the molecular formula C27H41F2N2O8S4+ and a molecular weight of 687.90 g/mol. Its IUPAC name is [3-[2-cyclohexyl-5-[2-(3-ethylsulfonyl-1,3-thiazolidin-1-ium-1-yl)-2-methylpropanoyl]phenyl]piperidin-1-yl]sulfonyl-difluoromethanesulfonic acid.
| Compound Name | [3-[2-cyclohexyl-5-[2-(3-ethylsulfonyl-1,3-thiazolidin-1-ium-1-yl)-2-methylpropanoyl]phenyl]piperidin-1-yl]sulfonyl-difluoromethanesulfonic acid |
|---|---|
| PubChem CID | 148975492 |
| Molecular Formula | C27H41F2N2O8S4+ |
| Molecular Weight | 687.90 g/mol |
| Exact Mass | 687.17 |
| IUPAC Name | [3-[2-cyclohexyl-5-[2-(3-ethylsulfonyl-1,3-thiazolidin-1-ium-1-yl)-2-methylpropanoyl]phenyl]piperidin-1-yl]sulfonyl-difluoromethanesulfonic acid |
| SMILES | CCS(=O)(=O)N1CC[S+](C(C)(C)C(=O)c2ccc(C3CCCCC3)c(C3CCCN(S(=O)(=O)C(F)(F)S(=O)(=O)O)C3)c2)C1 |
| InChI | InChI=1S/C27H40F2N2O8S4/c1-4-41(33,34)31-15-16-40(19-31)26(2,3)25(32)21-12-13-23(20-9-6-5-7-10-20)24(17-21)22-11-8-14-30(18-22)42(35,36)27(28,29)43(37,38)39/h12-13,17,20,22H,4-11,14-16,18-19H2,1-3H3/p+1 |
| InChIKey | PUSIPQHDLCWJQT-UHFFFAOYSA-O |
| XLogP | 3.88 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.90 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|