About (4-chlorophenyl)methyl trifluoromethanesulfinate
(4-chlorophenyl)methyl trifluoromethanesulfinate (PubChem CID 14897616) has the molecular formula C8H6ClF3O2S
and a molecular weight of 258.65 g/mol. Its IUPAC name is (4-chlorophenyl)methyl trifluoromethanesulfinate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl trifluoromethanesulfinate |
| PubChem CID | 14897616 |
| Molecular Formula | C8H6ClF3O2S |
| Molecular Weight | 258.65 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | (4-chlorophenyl)methyl trifluoromethanesulfinate |
| SMILES | O=S(OCc1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C8H6ClF3O2S/c9-7-3-1-6(2-4-7)5-14-15(13)8(10,11)12/h1-4H,5H2 |
| InChIKey | WGNKLWLSHPMJQG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.65 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)methyl trifluoromethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl trifluoromethanesulfinate?
The IUPAC name of (4-chlorophenyl)methyl trifluoromethanesulfinate (CID 14897616) is (4-chlorophenyl)methyl trifluoromethanesulfinate.
What is the SMILES notation for (4-chlorophenyl)methyl trifluoromethanesulfinate?
The canonical SMILES for (4-chlorophenyl)methyl trifluoromethanesulfinate is O=S(OCc1ccc(Cl)cc1)C(F)(F)F.
What is the InChIKey of (4-chlorophenyl)methyl trifluoromethanesulfinate?
The InChIKey is WGNKLWLSHPMJQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClF3O2S/c9-7-3-1-6(2-4-7)5-14-15(13)8(10,11)12/h1-4H,5H2.
What are the key properties of (4-chlorophenyl)methyl trifluoromethanesulfinate?
(4-chlorophenyl)methyl trifluoromethanesulfinate has a molecular weight of 258.65 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl trifluoromethanesulfinate is sourced from PubChem (CID 14897616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).