About 4-methyl-N-methylidenepentanamide
4-methyl-N-methylidenepentanamide (PubChem CID 148976283) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is 4-methyl-N-methylidenepentanamide.
Molecular Properties
| Compound Name | 4-methyl-N-methylidenepentanamide |
| PubChem CID | 148976283 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 4-methyl-N-methylidenepentanamide |
| SMILES | C=NC(=O)CCC(C)C |
| InChI | InChI=1S/C7H13NO/c1-6(2)4-5-7(9)8-3/h6H,3-5H2,1-2H3 |
| InChIKey | PUWDCOWSWWRRDZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-methylidenepentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-methylidenepentanamide?
The IUPAC name of 4-methyl-N-methylidenepentanamide (CID 148976283) is 4-methyl-N-methylidenepentanamide.
What is the SMILES notation for 4-methyl-N-methylidenepentanamide?
The canonical SMILES for 4-methyl-N-methylidenepentanamide is C=NC(=O)CCC(C)C.
What is the InChIKey of 4-methyl-N-methylidenepentanamide?
The InChIKey is PUWDCOWSWWRRDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-6(2)4-5-7(9)8-3/h6H,3-5H2,1-2H3.
What are the key properties of 4-methyl-N-methylidenepentanamide?
4-methyl-N-methylidenepentanamide has a molecular weight of 127.19 g/mol, XLogP of 1.65, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-methylidenepentanamide is sourced from PubChem (CID 148976283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).