C11H22OSi — CID 14897776
tert-butyl-dimethyl-[(2Z)-penta-2,4-dienoxy]silane (PubChem CID 14897776) has the molecular formula C11H22OSi and a molecular weight of 198.38 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2Z)-penta-2,4-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2Z)-penta-2,4-dienoxy]silane |
|---|---|
| PubChem CID | 14897776 |
| Molecular Formula | C11H22OSi |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | tert-butyl-dimethyl-[(2Z)-penta-2,4-dienoxy]silane |
| SMILES | C=C/C=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H22OSi/c1-7-8-9-10-12-13(5,6)11(2,3)4/h7-9H,1,10H2,2-6H3/b9-8- |
| InChIKey | XNLMIPUXHUNERO-HJWRWDBZSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|