About ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate
ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate (PubChem CID 14897846) has the molecular formula C10H10F2O4S
and a molecular weight of 264.25 g/mol. Its IUPAC name is ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate.
Molecular Properties
| Compound Name | ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate |
| PubChem CID | 14897846 |
| Molecular Formula | C10H10F2O4S |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H10F2O4S/c1-2-16-9(13)10(11,12)17(14,15)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | PDNMKBUQRNABKI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate?
The IUPAC name of ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate (CID 14897846) is ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate.
What is the SMILES notation for ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate?
The canonical SMILES for ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate is CCOC(=O)C(F)(F)S(=O)(=O)c1ccccc1.
What is the InChIKey of ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate?
The InChIKey is PDNMKBUQRNABKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2O4S/c1-2-16-9(13)10(11,12)17(14,15)8-6-4-3-5-7-8/h3-7H,2H2,1H3.
What are the key properties of ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate?
ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate has a molecular weight of 264.25 g/mol, XLogP of 1.62, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(benzenesulfonyl)-2,2-difluoroacetate is sourced from PubChem (CID 14897846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).