C26H20N14S2 — CID 148979613
2-N-[2-[[2-[(4-amino-6-pyrazin-2-yl-1,3,5-triazin-2-yl)amino]phenyl]disulfanyl]phenyl]-6-pyrazin-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 148979613) has the molecular formula C26H20N14S2 and a molecular weight of 592.68 g/mol. Its IUPAC name is 2-N-[2-[[2-[(4-amino-6-pyrazin-2-yl-1,3,5-triazin-2-yl)amino]phenyl]disulfanyl]phenyl]-6-pyrazin-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[[2-[(4-amino-6-pyrazin-2-yl-1,3,5-triazin-2-yl)amino]phenyl]disulfanyl]phenyl]-6-pyrazin-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 148979613 |
| Molecular Formula | C26H20N14S2 |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | 2-N-[2-[[2-[(4-amino-6-pyrazin-2-yl-1,3,5-triazin-2-yl)amino]phenyl]disulfanyl]phenyl]-6-pyrazin-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(Nc2ccccc2SSc2ccccc2Nc2nc(N)nc(-c3cnccn3)n2)nc(-c2cnccn2)n1 |
| InChI | InChI=1S/C26H20N14S2/c27-23-35-21(17-13-29-9-11-31-17)37-25(39-23)33-15-5-1-3-7-19(15)41-42-20-8-4-2-6-16(20)34-26-38-22(36-24(28)40-26)18-14-30-10-12-32-18/h1-14H,(H3,27,33,35,37,39)(H3,28,34,36,38,40) |
| InChIKey | PVLZRQFNAUIJBD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 205.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|