C15H12N2O5S2 — CID 1489797
1-[(5E)-5-[(3-hydroxy-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyrrolidine-2,5-dione (PubChem CID 1489797) has the molecular formula C15H12N2O5S2 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1-[(5E)-5-[(3-hydroxy-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(5E)-5-[(3-hydroxy-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1489797 |
| Molecular Formula | C15H12N2O5S2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 1-[(5E)-5-[(3-hydroxy-4-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(/C=C2/SC(=S)N(N3C(=O)CCC3=O)C2=O)cc1O |
| InChI | InChI=1S/C15H12N2O5S2/c1-22-10-3-2-8(6-9(10)18)7-11-14(21)17(15(23)24-11)16-12(19)4-5-13(16)20/h2-3,6-7,18H,4-5H2,1H3/b11-7+ |
| InChIKey | OMHKJDAJDHXPNV-YRNVUSSQSA-N |
| XLogP | 1.67 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|