C22H30O8 — CID 14898182
tetramethyl (4aS,4bR,8aS,10aR)-1,3,4,4a,4b,5,6,8,8a,10a-decahydrophenanthrene-2,2,7,7-tetracarboxylate (PubChem CID 14898182) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is tetramethyl (4aS,4bR,8aS,10aR)-1,3,4,4a,4b,5,6,8,8a,10a-decahydrophenanthrene-2,2,7,7-tetracarboxylate.
| Compound Name | tetramethyl (4aS,4bR,8aS,10aR)-1,3,4,4a,4b,5,6,8,8a,10a-decahydrophenanthrene-2,2,7,7-tetracarboxylate |
|---|---|
| PubChem CID | 14898182 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | tetramethyl (4aS,4bR,8aS,10aR)-1,3,4,4a,4b,5,6,8,8a,10a-decahydrophenanthrene-2,2,7,7-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC[C@H]2[C@H]3CCC(C(=O)OC)(C(=O)OC)C[C@@H]3C=C[C@@H]2C1 |
| InChI | InChI=1S/C22H30O8/c1-27-17(23)21(18(24)28-2)9-7-15-13(11-21)5-6-14-12-22(19(25)29-3,20(26)30-4)10-8-16(14)15/h5-6,13-16H,7-12H2,1-4H3/t13-,14+,15-,16+ |
| InChIKey | XBUWWOQIVSWZSH-GEEKYZPCSA-N |
| XLogP | 2.05 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|