About 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol
2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol (PubChem CID 148982987) has the molecular formula C9H12N2S
and a molecular weight of 180.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol.
Molecular Properties
| Compound Name | 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol |
| PubChem CID | 148982987 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol |
| SMILES | SCCc1ccc2c(c1)NCN2 |
| InChI | InChI=1S/C9H12N2S/c12-4-3-7-1-2-8-9(5-7)11-6-10-8/h1-2,5,10-12H,3-4,6H2 |
| InChIKey | PWCIFUPSVBBUAD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol?
The IUPAC name of 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol (CID 148982987) is 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol.
What is the SMILES notation for 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol?
The canonical SMILES for 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol is SCCc1ccc2c(c1)NCN2.
What is the InChIKey of 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol?
The InChIKey is PWCIFUPSVBBUAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2S/c12-4-3-7-1-2-8-9(5-7)11-6-10-8/h1-2,5,10-12H,3-4,6H2.
What are the key properties of 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol?
2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol has a molecular weight of 180.28 g/mol, XLogP of 1.95, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1H-benzimidazol-5-yl)ethanethiol is sourced from PubChem (CID 148982987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).