C14H20N2 — CID 148987341
(4R)-1-[(4-methylphenyl)methyl]-1,7-diazaspiro[3.4]octane (PubChem CID 148987341) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (4R)-1-[(4-methylphenyl)methyl]-1,7-diazaspiro[3.4]octane.
| Compound Name | (4R)-1-[(4-methylphenyl)methyl]-1,7-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 148987341 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (4R)-1-[(4-methylphenyl)methyl]-1,7-diazaspiro[3.4]octane |
| SMILES | Cc1ccc(CN2CC[C@@]23CCNC3)cc1 |
| InChI | InChI=1S/C14H20N2/c1-12-2-4-13(5-3-12)10-16-9-7-14(16)6-8-15-11-14/h2-5,15H,6-11H2,1H3/t14-/m1/s1 |
| InChIKey | PXAAQTGOTIUFFX-CQSZACIVSA-N |
| XLogP | 1.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |