C9H14N4O — CID 14898759
N,N-dimethyl-5-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,4-oxadiazol-3-amine (PubChem CID 14898759) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is N,N-dimethyl-5-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,4-oxadiazol-3-amine.
| Compound Name | N,N-dimethyl-5-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 14898759 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N,N-dimethyl-5-(1,2,3,6-tetrahydropyridin-5-yl)-1,2,4-oxadiazol-3-amine |
| SMILES | CN(C)c1noc(C2=CCCNC2)n1 |
| InChI | InChI=1S/C9H14N4O/c1-13(2)9-11-8(14-12-9)7-4-3-5-10-6-7/h4,10H,3,5-6H2,1-2H3 |
| InChIKey | AEXVMBRXEWEYEF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |