About 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran
2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran (PubChem CID 14898815) has the molecular formula C8H8F6O
and a molecular weight of 234.14 g/mol. Its IUPAC name is 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran.
Molecular Properties
| Compound Name | 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran |
| PubChem CID | 14898815 |
| Molecular Formula | C8H8F6O |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran |
| SMILES | CC1C=CCC(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C8H8F6O/c1-5-3-2-4-6(15-5,7(9,10)11)8(12,13)14/h2-3,5H,4H2,1H3 |
| InChIKey | YVXATHGJBLWUNV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran?
The IUPAC name of 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran (CID 14898815) is 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran.
What is the SMILES notation for 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran?
The canonical SMILES for 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran is CC1C=CCC(C(F)(F)F)(C(F)(F)F)O1.
What is the InChIKey of 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran?
The InChIKey is YVXATHGJBLWUNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F6O/c1-5-3-2-4-6(15-5,7(9,10)11)8(12,13)14/h2-3,5H,4H2,1H3.
What are the key properties of 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran?
2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran has a molecular weight of 234.14 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6,6-bis(trifluoromethyl)-2,5-dihydropyran is sourced from PubChem (CID 14898815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).