About N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide
N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide (PubChem CID 1489917) has the molecular formula C19H25N3O3S
and a molecular weight of 375.49 g/mol. Its IUPAC name is N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide.
Molecular Properties
| Compound Name | N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide |
| PubChem CID | 1489917 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide |
| SMILES | Cc1cc(-c2ccccc2)nc(N(C)NC(=O)C(C)(C)C)c1S(C)(=O)=O |
| InChI | InChI=1S/C19H25N3O3S/c1-13-12-15(14-10-8-7-9-11-14)20-17(16(13)26(6,24)25)22(5)21-18(23)19(2,3)4/h7-12H,1-6H3,(H,21,23) |
| InChIKey | BNWPELOTHLDVSS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide?
The IUPAC name of N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide (CID 1489917) is N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide.
What is the SMILES notation for N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide?
The canonical SMILES for N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide is Cc1cc(-c2ccccc2)nc(N(C)NC(=O)C(C)(C)C)c1S(C)(=O)=O.
What is the InChIKey of N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide?
The InChIKey is BNWPELOTHLDVSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O3S/c1-13-12-15(14-10-8-7-9-11-14)20-17(16(13)26(6,24)25)22(5)21-18(23)19(2,3)4/h7-12H,1-6H3,(H,21,23).
What are the key properties of N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide?
N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide has a molecular weight of 375.49 g/mol, XLogP of 2.97, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N',2,2-trimethyl-N'-(4-methyl-3-methylsulfonyl-6-phenyl-2-pyridinyl)propanehydrazide is sourced from PubChem (CID 1489917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).