About 5-propyl-1,2-dihydropyridin-2-ol
5-propyl-1,2-dihydropyridin-2-ol (PubChem CID 148992183) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 5-propyl-1,2-dihydropyridin-2-ol.
Molecular Properties
| Compound Name | 5-propyl-1,2-dihydropyridin-2-ol |
| PubChem CID | 148992183 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 5-propyl-1,2-dihydropyridin-2-ol |
| SMILES | CCCC1=CNC(O)C=C1 |
| InChI | InChI=1S/C8H13NO/c1-2-3-7-4-5-8(10)9-6-7/h4-6,8-10H,2-3H2,1H3 |
| InChIKey | PXXNTPMZWDUOOI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-propyl-1,2-dihydropyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propyl-1,2-dihydropyridin-2-ol?
The IUPAC name of 5-propyl-1,2-dihydropyridin-2-ol (CID 148992183) is 5-propyl-1,2-dihydropyridin-2-ol.
What is the SMILES notation for 5-propyl-1,2-dihydropyridin-2-ol?
The canonical SMILES for 5-propyl-1,2-dihydropyridin-2-ol is CCCC1=CNC(O)C=C1.
What is the InChIKey of 5-propyl-1,2-dihydropyridin-2-ol?
The InChIKey is PXXNTPMZWDUOOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-2-3-7-4-5-8(10)9-6-7/h4-6,8-10H,2-3H2,1H3.
What are the key properties of 5-propyl-1,2-dihydropyridin-2-ol?
5-propyl-1,2-dihydropyridin-2-ol has a molecular weight of 139.20 g/mol, XLogP of 1.15, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propyl-1,2-dihydropyridin-2-ol is sourced from PubChem (CID 148992183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).