C11H14F3N3 — CID 148992394
5-amino-4-(4,4,4-trifluorobutylamino)cyclohexa-1,3-diene-1-carbonitrile (PubChem CID 148992394) has the molecular formula C11H14F3N3 and a molecular weight of 245.25 g/mol. Its IUPAC name is 5-amino-4-(4,4,4-trifluorobutylamino)cyclohexa-1,3-diene-1-carbonitrile.
| Compound Name | 5-amino-4-(4,4,4-trifluorobutylamino)cyclohexa-1,3-diene-1-carbonitrile |
|---|---|
| PubChem CID | 148992394 |
| Molecular Formula | C11H14F3N3 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 5-amino-4-(4,4,4-trifluorobutylamino)cyclohexa-1,3-diene-1-carbonitrile |
| SMILES | N#CC1=CC=C(NCCCC(F)(F)F)C(N)C1 |
| InChI | InChI=1S/C11H14F3N3/c12-11(13,14)4-1-5-17-10-3-2-8(7-15)6-9(10)16/h2-3,9,17H,1,4-6,16H2 |
| InChIKey | PXYMORZQUPMSNV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|