C9H8O6 — CID 148993007
9-hydroxy-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,5,11-trione (PubChem CID 148993007) has the molecular formula C9H8O6 and a molecular weight of 212.16 g/mol. Its IUPAC name is 9-hydroxy-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,5,11-trione.
| Compound Name | 9-hydroxy-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,5,11-trione |
|---|---|
| PubChem CID | 148993007 |
| Molecular Formula | C9H8O6 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 9-hydroxy-4,10-dioxatricyclo[6.3.0.02,6]undecane-3,5,11-trione |
| SMILES | O=C1OC(=O)C2C1CC1C(O)OC(=O)C12 |
| InChI | InChI=1S/C9H8O6/c10-6-2-1-3-5(4(2)8(12)14-6)9(13)15-7(3)11/h2-6,10H,1H2 |
| InChIKey | PYBLBLQGKFJKCH-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|