C17H28BF3O3 — CID 148993635
2-[4-ethyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 148993635) has the molecular formula C17H28BF3O3 and a molecular weight of 348.21 g/mol. Its IUPAC name is 2-[4-ethyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-ethyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 148993635 |
| Molecular Formula | C17H28BF3O3 |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-[4-ethyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCC1(COCC(F)(F)F)CC=C(B2OC(C)(C)C(C)(C)O2)CC1 |
| InChI | InChI=1S/C17H28BF3O3/c1-6-16(11-22-12-17(19,20)21)9-7-13(8-10-16)18-23-14(2,3)15(4,5)24-18/h7H,6,8-12H2,1-5H3 |
| InChIKey | PYEHNLLAVZGOIT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|