C28H27ClFN5O3 — CID 148994168
1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-methoxyquinazolin-6-yl]-5-(dimethylamino)-3-fluoropent-3-en-2-one (PubChem CID 148994168) has the molecular formula C28H27ClFN5O3 and a molecular weight of 536.01 g/mol. Its IUPAC name is 1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-methoxyquinazolin-6-yl]-5-(dimethylamino)-3-fluoropent-3-en-2-one.
| Compound Name | 1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-methoxyquinazolin-6-yl]-5-(dimethylamino)-3-fluoropent-3-en-2-one |
|---|---|
| PubChem CID | 148994168 |
| Molecular Formula | C28H27ClFN5O3 |
| Molecular Weight | 536.01 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-methoxyquinazolin-6-yl]-5-(dimethylamino)-3-fluoropent-3-en-2-one |
| SMILES | COc1cc2ncnc(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2cc1CC(=O)C(F)=CCN(C)C |
| InChI | InChI=1S/C28H27ClFN5O3/c1-35(2)11-9-23(30)25(36)13-18-12-21-24(15-27(18)37-3)32-17-33-28(21)34-19-7-8-26(22(29)14-19)38-16-20-6-4-5-10-31-20/h4-10,12,14-15,17H,11,13,16H2,1-3H3,(H,32,33,34) |
| InChIKey | PYGWCTBKFUFPAN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.01 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|