C14H19NO3S — CID 14899550
5-(benzenesulfonyl)-1,2,2-trimethylpiperidin-4-one (PubChem CID 14899550) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-1,2,2-trimethylpiperidin-4-one.
| Compound Name | 5-(benzenesulfonyl)-1,2,2-trimethylpiperidin-4-one |
|---|---|
| PubChem CID | 14899550 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 5-(benzenesulfonyl)-1,2,2-trimethylpiperidin-4-one |
| SMILES | CN1CC(S(=O)(=O)c2ccccc2)C(=O)CC1(C)C |
| InChI | InChI=1S/C14H19NO3S/c1-14(2)9-12(16)13(10-15(14)3)19(17,18)11-7-5-4-6-8-11/h4-8,13H,9-10H2,1-3H3 |
| InChIKey | CRAKMQKFDSKQAC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |