C19H26FN3O5 — CID 148996887
5-fluoro-6-[[(1R,4S,5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]amino]-1H-pyrimidin-2-one (PubChem CID 148996887) has the molecular formula C19H26FN3O5 and a molecular weight of 395.43 g/mol. Its IUPAC name is 5-fluoro-6-[[(1R,4S,5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]amino]-1H-pyrimidin-2-one.
| Compound Name | 5-fluoro-6-[[(1R,4S,5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]amino]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 148996887 |
| Molecular Formula | C19H26FN3O5 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 5-fluoro-6-[[(1R,4S,5R,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]amino]-1H-pyrimidin-2-one |
| SMILES | C[C@H]1C(Nc2[nH]c(=O)ncc2F)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CCC1[C@@]24OO3 |
| InChI | InChI=1S/C19H26FN3O5/c1-9-4-5-12-10(2)15(22-14-13(20)8-21-17(24)23-14)25-16-19(12)11(9)6-7-18(3,26-16)27-28-19/h8-12,15-16H,4-7H2,1-3H3,(H2,21,22,23,24)/t9-,10-,11+,12?,15?,16-,18-,19-/m1/s1 |
| InChIKey | PYWARBGVUHQNEB-GMNPTEHGSA-N |
| XLogP | 2.53 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|