About 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide
6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide (PubChem CID 1489974) has the molecular formula C18H12F3N3O2
and a molecular weight of 359.31 g/mol. Its IUPAC name is 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide |
| PubChem CID | 1489974 |
| Molecular Formula | C18H12F3N3O2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1nn(-c2ccccc2)c(=O)cc1C(F)(F)F |
| InChI | InChI=1S/C18H12F3N3O2/c19-18(20,21)14-11-15(25)24(13-9-5-2-6-10-13)23-16(14)17(26)22-12-7-3-1-4-8-12/h1-11H,(H,22,26) |
| InChIKey | YYTVOLJZTNAIAF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide?
The IUPAC name of 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide (CID 1489974) is 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide.
What is the SMILES notation for 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide?
The canonical SMILES for 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide is O=C(Nc1ccccc1)c1nn(-c2ccccc2)c(=O)cc1C(F)(F)F.
What is the InChIKey of 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide?
The InChIKey is YYTVOLJZTNAIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F3N3O2/c19-18(20,21)14-11-15(25)24(13-9-5-2-6-10-13)23-16(14)17(26)22-12-7-3-1-4-8-12/h1-11H,(H,22,26).
What are the key properties of 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide?
6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide has a molecular weight of 359.31 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-N,1-diphenyl-4-(trifluoromethyl)pyridazine-3-carboxamide is sourced from PubChem (CID 1489974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).