About 3,6,6-trimethyl-1,3-thiazinane
3,6,6-trimethyl-1,3-thiazinane (PubChem CID 148997562) has the molecular formula C7H15NS
and a molecular weight of 145.27 g/mol. Its IUPAC name is 3,6,6-trimethyl-1,3-thiazinane.
Molecular Properties
| Compound Name | 3,6,6-trimethyl-1,3-thiazinane |
| PubChem CID | 148997562 |
| Molecular Formula | C7H15NS |
| Molecular Weight | 145.27 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3,6,6-trimethyl-1,3-thiazinane |
| SMILES | CN1CCC(C)(C)SC1 |
| InChI | InChI=1S/C7H15NS/c1-7(2)4-5-8(3)6-9-7/h4-6H2,1-3H3 |
| InChIKey | PYZLQISUWBUERQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6,6-trimethyl-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6,6-trimethyl-1,3-thiazinane?
The IUPAC name of 3,6,6-trimethyl-1,3-thiazinane (CID 148997562) is 3,6,6-trimethyl-1,3-thiazinane.
What is the SMILES notation for 3,6,6-trimethyl-1,3-thiazinane?
The canonical SMILES for 3,6,6-trimethyl-1,3-thiazinane is CN1CCC(C)(C)SC1.
What is the InChIKey of 3,6,6-trimethyl-1,3-thiazinane?
The InChIKey is PYZLQISUWBUERQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NS/c1-7(2)4-5-8(3)6-9-7/h4-6H2,1-3H3.
What are the key properties of 3,6,6-trimethyl-1,3-thiazinane?
3,6,6-trimethyl-1,3-thiazinane has a molecular weight of 145.27 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6,6-trimethyl-1,3-thiazinane is sourced from PubChem (CID 148997562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).