C28H28F3N3O4 — CID 148999720
(2S)-5-[2-[(3R,5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]acetyl]-1'-methylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione (PubChem CID 148999720) has the molecular formula C28H28F3N3O4 and a molecular weight of 527.54 g/mol. Its IUPAC name is (2S)-5-[2-[(3R,5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]acetyl]-1'-methylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione.
| Compound Name | (2S)-5-[2-[(3R,5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]acetyl]-1'-methylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 148999720 |
| Molecular Formula | C28H28F3N3O4 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | (2S)-5-[2-[(3R,5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]acetyl]-1'-methylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
| SMILES | CCN1C(=O)[C@@H](CC(=O)c2ccc3c(c2)C[C@@]2(C3)C(=O)NC(=O)N2C)C[C@@H](c2cc(F)cc(F)c2F)[C@H]1C |
| InChI | InChI=1S/C28H28F3N3O4/c1-4-34-14(2)20(21-10-19(29)11-22(30)24(21)31)8-17(25(34)36)9-23(35)15-5-6-16-12-28(13-18(16)7-15)26(37)32-27(38)33(28)3/h5-7,10-11,14,17,20H,4,8-9,12-13H2,1-3H3,(H,32,37,38)/t14-,17-,20-,28+/m1/s1 |
| InChIKey | PZKGYZARVKAHQG-ITSZWFEXSA-N |
| XLogP | 3.74 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|