About methyl 4-(2,4-dichlorophenoxy)butanoate
methyl 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 1490) has the molecular formula C11H12Cl2O3
and a molecular weight of 263.12 g/mol. Its IUPAC name is methyl 4-(2,4-dichlorophenoxy)butanoate.
Molecular Properties
| Compound Name | methyl 4-(2,4-dichlorophenoxy)butanoate |
| PubChem CID | 1490 |
| Molecular Formula | C11H12Cl2O3 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | methyl 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | COC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2O3/c1-15-11(14)3-2-6-16-10-5-4-8(12)7-9(10)13/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | NKXSNMCGZZWMMW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(2,4-dichlorophenoxy)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2,4-dichlorophenoxy)butanoate?
The IUPAC name of methyl 4-(2,4-dichlorophenoxy)butanoate (CID 1490) is methyl 4-(2,4-dichlorophenoxy)butanoate.
What is the SMILES notation for methyl 4-(2,4-dichlorophenoxy)butanoate?
The canonical SMILES for methyl 4-(2,4-dichlorophenoxy)butanoate is COC(=O)CCCOc1ccc(Cl)cc1Cl.
What is the InChIKey of methyl 4-(2,4-dichlorophenoxy)butanoate?
The InChIKey is NKXSNMCGZZWMMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2O3/c1-15-11(14)3-2-6-16-10-5-4-8(12)7-9(10)13/h4-5,7H,2-3,6H2,1H3.
What are the key properties of methyl 4-(2,4-dichlorophenoxy)butanoate?
methyl 4-(2,4-dichlorophenoxy)butanoate has a molecular weight of 263.12 g/mol, XLogP of 3.33, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,4-dichlorophenoxy)butanoate is sourced from PubChem (CID 1490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).