About 6-acetylindolizino[2,3-g]quinoline-5,12-dione
6-acetylindolizino[2,3-g]quinoline-5,12-dione (PubChem CID 14900031) has the molecular formula C17H10N2O3
and a molecular weight of 290.28 g/mol. Its IUPAC name is 6-acetylindolizino[2,3-g]quinoline-5,12-dione.
Molecular Properties
| Compound Name | 6-acetylindolizino[2,3-g]quinoline-5,12-dione |
| PubChem CID | 14900031 |
| Molecular Formula | C17H10N2O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 6-acetylindolizino[2,3-g]quinoline-5,12-dione |
| SMILES | CC(=O)c1c2c(n3ccccc13)C(=O)c1ncccc1C2=O |
| InChI | InChI=1S/C17H10N2O3/c1-9(20)12-11-6-2-3-8-19(11)15-13(12)16(21)10-5-4-7-18-14(10)17(15)22/h2-8H,1H3 |
| InChIKey | YAQCCSGFBJCUTD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 68.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 6-acetylindolizino[2,3-g]quinoline-5,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetylindolizino[2,3-g]quinoline-5,12-dione?
The IUPAC name of 6-acetylindolizino[2,3-g]quinoline-5,12-dione (CID 14900031) is 6-acetylindolizino[2,3-g]quinoline-5,12-dione.
What is the SMILES notation for 6-acetylindolizino[2,3-g]quinoline-5,12-dione?
The canonical SMILES for 6-acetylindolizino[2,3-g]quinoline-5,12-dione is CC(=O)c1c2c(n3ccccc13)C(=O)c1ncccc1C2=O.
What is the InChIKey of 6-acetylindolizino[2,3-g]quinoline-5,12-dione?
The InChIKey is YAQCCSGFBJCUTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N2O3/c1-9(20)12-11-6-2-3-8-19(11)15-13(12)16(21)10-5-4-7-18-14(10)17(15)22/h2-8H,1H3.
What are the key properties of 6-acetylindolizino[2,3-g]quinoline-5,12-dione?
6-acetylindolizino[2,3-g]quinoline-5,12-dione has a molecular weight of 290.28 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetylindolizino[2,3-g]quinoline-5,12-dione is sourced from PubChem (CID 14900031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).