C12H19F3O — CID 14900078
(2R)-2-[(1R)-cyclohex-2-en-1-yl]-1,1,1-trifluoro-3-methylpentan-2-ol (PubChem CID 14900078) has the molecular formula C12H19F3O and a molecular weight of 236.28 g/mol. Its IUPAC name is (2R)-2-[(1R)-cyclohex-2-en-1-yl]-1,1,1-trifluoro-3-methylpentan-2-ol.
| Compound Name | (2R)-2-[(1R)-cyclohex-2-en-1-yl]-1,1,1-trifluoro-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 14900078 |
| Molecular Formula | C12H19F3O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2R)-2-[(1R)-cyclohex-2-en-1-yl]-1,1,1-trifluoro-3-methylpentan-2-ol |
| SMILES | CCC(C)[C@@](O)([C@H]1C=CCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H19F3O/c1-3-9(2)11(16,12(13,14)15)10-7-5-4-6-8-10/h5,7,9-10,16H,3-4,6,8H2,1-2H3/t9?,10-,11+/m0/s1 |
| InChIKey | QTCWLQHGSQXQKU-QXXIUIOUSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|