C29H32F2N6O2 — CID 149002563
5-(3,4-difluorophenyl)-N-[(1R,2S)-2-[[(3R)-1-[6-(5-methyl-1,2,4-oxadiazol-3-yl)-3-pyridinyl]piperidin-3-yl]methyl]cyclohexyl]-1,3-oxazol-2-amine (PubChem CID 149002563) has the molecular formula C29H32F2N6O2 and a molecular weight of 534.61 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-N-[(1R,2S)-2-[[(3R)-1-[6-(5-methyl-1,2,4-oxadiazol-3-yl)-3-pyridinyl]piperidin-3-yl]methyl]cyclohexyl]-1,3-oxazol-2-amine.
| Compound Name | 5-(3,4-difluorophenyl)-N-[(1R,2S)-2-[[(3R)-1-[6-(5-methyl-1,2,4-oxadiazol-3-yl)-3-pyridinyl]piperidin-3-yl]methyl]cyclohexyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 149002563 |
| Molecular Formula | C29H32F2N6O2 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 5-(3,4-difluorophenyl)-N-[(1R,2S)-2-[[(3R)-1-[6-(5-methyl-1,2,4-oxadiazol-3-yl)-3-pyridinyl]piperidin-3-yl]methyl]cyclohexyl]-1,3-oxazol-2-amine |
| SMILES | Cc1nc(-c2ccc(N3CCC[C@H](C[C@@H]4CCCC[C@H]4Nc4ncc(-c5ccc(F)c(F)c5)o4)C3)cn2)no1 |
| InChI | InChI=1S/C29H32F2N6O2/c1-18-34-28(36-39-18)26-11-9-22(15-32-26)37-12-4-5-19(17-37)13-20-6-2-3-7-25(20)35-29-33-16-27(38-29)21-8-10-23(30)24(31)14-21/h8-11,14-16,19-20,25H,2-7,12-13,17H2,1H3,(H,33,35)/t19-,20+,25-/m1/s1 |
| InChIKey | PZYBOEDPYFLFMU-OHUGHZGNSA-N |
| XLogP | 6.65 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |