C11H19N5 — CID 149005303
4-cyclohexa-1,5-dien-1-yl-1,3-dimethyl-2,4-dihydro-1,3,5-triazine-2,6-diamine (PubChem CID 149005303) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-1,3-dimethyl-2,4-dihydro-1,3,5-triazine-2,6-diamine.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-1,3-dimethyl-2,4-dihydro-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 149005303 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-1,3-dimethyl-2,4-dihydro-1,3,5-triazine-2,6-diamine |
| SMILES | CN1C(N)=NC(C2=CCCC=C2)N(C)C1N |
| InChI | InChI=1S/C11H19N5/c1-15-9(8-6-4-3-5-7-8)14-10(12)16(2)11(15)13/h4,6-7,9,11H,3,5,13H2,1-2H3,(H2,12,14) |
| InChIKey | QALIRCHPXOZSIS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |