About 3-chloro-2,5-dimethylthiophene
3-chloro-2,5-dimethylthiophene (PubChem CID 14900750) has the molecular formula C6H7ClS
and a molecular weight of 146.64 g/mol. Its IUPAC name is 3-chloro-2,5-dimethylthiophene.
Molecular Properties
| Compound Name | 3-chloro-2,5-dimethylthiophene |
| PubChem CID | 14900750 |
| Molecular Formula | C6H7ClS |
| Molecular Weight | 146.64 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 3-chloro-2,5-dimethylthiophene |
| SMILES | Cc1cc(Cl)c(C)s1 |
| InChI | InChI=1S/C6H7ClS/c1-4-3-6(7)5(2)8-4/h3H,1-2H3 |
| InChIKey | PHGYDZAYLOPRSV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloro-2,5-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,5-dimethylthiophene?
The IUPAC name of 3-chloro-2,5-dimethylthiophene (CID 14900750) is 3-chloro-2,5-dimethylthiophene.
What is the SMILES notation for 3-chloro-2,5-dimethylthiophene?
The canonical SMILES for 3-chloro-2,5-dimethylthiophene is Cc1cc(Cl)c(C)s1.
What is the InChIKey of 3-chloro-2,5-dimethylthiophene?
The InChIKey is PHGYDZAYLOPRSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClS/c1-4-3-6(7)5(2)8-4/h3H,1-2H3.
What are the key properties of 3-chloro-2,5-dimethylthiophene?
3-chloro-2,5-dimethylthiophene has a molecular weight of 146.64 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,5-dimethylthiophene is sourced from PubChem (CID 14900750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).