About 6-butan-2-yl-3,4-dihydro-2H-thiopyran
6-butan-2-yl-3,4-dihydro-2H-thiopyran (PubChem CID 14900893) has the molecular formula C9H16S
and a molecular weight of 156.29 g/mol. Its IUPAC name is 6-butan-2-yl-3,4-dihydro-2H-thiopyran.
Molecular Properties
| Compound Name | 6-butan-2-yl-3,4-dihydro-2H-thiopyran |
| PubChem CID | 14900893 |
| Molecular Formula | C9H16S |
| Molecular Weight | 156.29 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 6-butan-2-yl-3,4-dihydro-2H-thiopyran |
| SMILES | CCC(C)C1=CCCCS1 |
| InChI | InChI=1S/C9H16S/c1-3-8(2)9-6-4-5-7-10-9/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | HWIBAFZRKLITPT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-butan-2-yl-3,4-dihydro-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butan-2-yl-3,4-dihydro-2H-thiopyran?
The IUPAC name of 6-butan-2-yl-3,4-dihydro-2H-thiopyran (CID 14900893) is 6-butan-2-yl-3,4-dihydro-2H-thiopyran.
What is the SMILES notation for 6-butan-2-yl-3,4-dihydro-2H-thiopyran?
The canonical SMILES for 6-butan-2-yl-3,4-dihydro-2H-thiopyran is CCC(C)C1=CCCCS1.
What is the InChIKey of 6-butan-2-yl-3,4-dihydro-2H-thiopyran?
The InChIKey is HWIBAFZRKLITPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16S/c1-3-8(2)9-6-4-5-7-10-9/h6,8H,3-5,7H2,1-2H3.
What are the key properties of 6-butan-2-yl-3,4-dihydro-2H-thiopyran?
6-butan-2-yl-3,4-dihydro-2H-thiopyran has a molecular weight of 156.29 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butan-2-yl-3,4-dihydro-2H-thiopyran is sourced from PubChem (CID 14900893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).