C23H26ClF2NO — CID 149011393
(3R)-1-(4-chlorophenyl)-3-[4-[6-(difluoromethyl)-2-pyridinyl]cyclohexyl]pentan-1-one (PubChem CID 149011393) has the molecular formula C23H26ClF2NO and a molecular weight of 405.92 g/mol. Its IUPAC name is (3R)-1-(4-chlorophenyl)-3-[4-[6-(difluoromethyl)-2-pyridinyl]cyclohexyl]pentan-1-one.
| Compound Name | (3R)-1-(4-chlorophenyl)-3-[4-[6-(difluoromethyl)-2-pyridinyl]cyclohexyl]pentan-1-one |
|---|---|
| PubChem CID | 149011393 |
| Molecular Formula | C23H26ClF2NO |
| Molecular Weight | 405.92 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (3R)-1-(4-chlorophenyl)-3-[4-[6-(difluoromethyl)-2-pyridinyl]cyclohexyl]pentan-1-one |
| SMILES | CC[C@H](CC(=O)c1ccc(Cl)cc1)C1CCC(c2cccc(C(F)F)n2)CC1 |
| InChI | InChI=1S/C23H26ClF2NO/c1-2-15(14-22(28)18-10-12-19(24)13-11-18)16-6-8-17(9-7-16)20-4-3-5-21(27-20)23(25)26/h3-5,10-13,15-17,23H,2,6-9,14H2,1H3/t15-,16?,17?/m1/s1 |
| InChIKey | QBPGNIOFKPURED-KLAILNCOSA-N |
| XLogP | 7.25 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.92 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |