About trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid
trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid (PubChem CID 14901341) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid |
| PubChem CID | 14901341 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid |
| SMILES | CN[C@@H]1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C8H15NO2/c1-9-7-5-3-2-4-6(7)8(10)11/h6-7,9H,2-5H2,1H3,(H,10,11)/t6-,7-/m1/s1 |
| InChIKey | WBWLQVJMCJPYHB-RNFRBKRXSA-N |
| XLogP | 0.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid?
The IUPAC name of trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid (CID 14901341) is trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid.
What is the SMILES notation for trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid?
The canonical SMILES for trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid is CN[C@@H]1CCCC[C@H]1C(=O)O.
What is the InChIKey of trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid?
The InChIKey is WBWLQVJMCJPYHB-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H15NO2/c1-9-7-5-3-2-4-6(7)8(10)11/h6-7,9H,2-5H2,1H3,(H,10,11)/t6-,7-/m1/s1.
What are the key properties of trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid?
trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid has a molecular weight of 157.21 g/mol, XLogP of 0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(methylamino)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 14901341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).