About (10-methyl-2,3-dihydroanthracen-9-yl)alumane
(10-methyl-2,3-dihydroanthracen-9-yl)alumane (PubChem CID 149013478) has the molecular formula C15H15Al
and a molecular weight of 222.27 g/mol. Its IUPAC name is (10-methyl-2,3-dihydroanthracen-9-yl)alumane.
Molecular Properties
| Compound Name | (10-methyl-2,3-dihydroanthracen-9-yl)alumane |
| PubChem CID | 149013478 |
| Molecular Formula | C15H15Al |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (10-methyl-2,3-dihydroanthracen-9-yl)alumane |
| SMILES | Cc1c2c(c([AlH2])c3ccccc13)=CCCC=2 |
| InChI | InChI=1S/C15H13.Al.2H/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;;;/h2,4,6-9H,3,5H2,1H3;;; |
| InChIKey | QCCAJGYPFPLHRM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (10-methyl-2,3-dihydroanthracen-9-yl)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10-methyl-2,3-dihydroanthracen-9-yl)alumane?
The IUPAC name of (10-methyl-2,3-dihydroanthracen-9-yl)alumane (CID 149013478) is (10-methyl-2,3-dihydroanthracen-9-yl)alumane.
What is the SMILES notation for (10-methyl-2,3-dihydroanthracen-9-yl)alumane?
The canonical SMILES for (10-methyl-2,3-dihydroanthracen-9-yl)alumane is Cc1c2c(c([AlH2])c3ccccc13)=CCCC=2.
What is the InChIKey of (10-methyl-2,3-dihydroanthracen-9-yl)alumane?
The InChIKey is QCCAJGYPFPLHRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13.Al.2H/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;;;/h2,4,6-9H,3,5H2,1H3;;;.
What are the key properties of (10-methyl-2,3-dihydroanthracen-9-yl)alumane?
(10-methyl-2,3-dihydroanthracen-9-yl)alumane has a molecular weight of 222.27 g/mol, XLogP of 0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (10-methyl-2,3-dihydroanthracen-9-yl)alumane is sourced from PubChem (CID 149013478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).