C18H13Cl2N5O4 — CID 149014837
2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]-6-ethynyl-1,2,4-triazine-3,5-dione (PubChem CID 149014837) has the molecular formula C18H13Cl2N5O4 and a molecular weight of 434.24 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]-6-ethynyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]-6-ethynyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 149014837 |
| Molecular Formula | C18H13Cl2N5O4 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 2-[3,5-dichloro-4-[(6-oxo-5-propan-2-yl-1H-pyridazin-3-yl)oxy]phenyl]-6-ethynyl-1,2,4-triazine-3,5-dione |
| SMILES | C#Cc1nn(-c2cc(Cl)c(Oc3cc(C(C)C)c(=O)[nH]n3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H13Cl2N5O4/c1-4-13-17(27)21-18(28)25(24-13)9-5-11(19)15(12(20)6-9)29-14-7-10(8(2)3)16(26)23-22-14/h1,5-8H,2-3H3,(H,23,26)(H,21,27,28) |
| InChIKey | QCIHRHXQTADCLN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|