C11H14O5 — CID 14901565
(3aR,7S,7aR)-7-methoxy-3a,7a-dimethyl-6,7-dihydro-4H-2-benzofuran-1,3,5-trione (PubChem CID 14901565) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is (3aR,7S,7aR)-7-methoxy-3a,7a-dimethyl-6,7-dihydro-4H-2-benzofuran-1,3,5-trione.
| Compound Name | (3aR,7S,7aR)-7-methoxy-3a,7a-dimethyl-6,7-dihydro-4H-2-benzofuran-1,3,5-trione |
|---|---|
| PubChem CID | 14901565 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (3aR,7S,7aR)-7-methoxy-3a,7a-dimethyl-6,7-dihydro-4H-2-benzofuran-1,3,5-trione |
| SMILES | CO[C@H]1CC(=O)C[C@@]2(C)C(=O)OC(=O)[C@@]12C |
| InChI | InChI=1S/C11H14O5/c1-10-5-6(12)4-7(15-3)11(10,2)9(14)16-8(10)13/h7H,4-5H2,1-3H3/t7-,10-,11+/m0/s1 |
| InChIKey | FNNQAXLKLKOIPR-BKDNQFJXSA-N |
| XLogP | 0.46 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|