About sodium dianthracen-9-yl phosphate
sodium dianthracen-9-yl phosphate (PubChem CID 149016466) has the molecular formula C28H18NaO4P
and a molecular weight of 472.41 g/mol. Its IUPAC name is sodium dianthracen-9-yl phosphate.
Molecular Properties
| Compound Name | sodium dianthracen-9-yl phosphate |
| PubChem CID | 149016466 |
| Molecular Formula | C28H18NaO4P |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | sodium dianthracen-9-yl phosphate |
| SMILES | O=P([O-])(Oc1c2ccccc2cc2ccccc12)Oc1c2ccccc2cc2ccccc12.[Na+] |
| InChI | InChI=1S/C28H19O4P.Na/c29-33(30,31-27-23-13-5-1-9-19(23)17-20-10-2-6-14-24(20)27)32-28-25-15-7-3-11-21(25)18-22-12-4-8-16-26(22)28;/h1-18H,(H,29,30);/q;+1/p-1 |
| InChIKey | QCQBGVURGMVXJA-UHFFFAOYSA-M |
| XLogP | 4.23 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze sodium dianthracen-9-yl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium dianthracen-9-yl phosphate?
The IUPAC name of sodium dianthracen-9-yl phosphate (CID 149016466) is sodium dianthracen-9-yl phosphate.
What is the SMILES notation for sodium dianthracen-9-yl phosphate?
The canonical SMILES for sodium dianthracen-9-yl phosphate is O=P([O-])(Oc1c2ccccc2cc2ccccc12)Oc1c2ccccc2cc2ccccc12.[Na+].
What is the InChIKey of sodium dianthracen-9-yl phosphate?
The InChIKey is QCQBGVURGMVXJA-UHFFFAOYSA-M. The full InChI is InChI=1S/C28H19O4P.Na/c29-33(30,31-27-23-13-5-1-9-19(23)17-20-10-2-6-14-24(20)27)32-28-25-15-7-3-11-21(25)18-22-12-4-8-16-26(22)28;/h1-18H,(H,29,30);/q;+1/p-1.
What are the key properties of sodium dianthracen-9-yl phosphate?
sodium dianthracen-9-yl phosphate has a molecular weight of 472.41 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium dianthracen-9-yl phosphate is sourced from PubChem (CID 149016466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).