C28H26FNO5S — CID 149021673
1-[6-(7-fluoro-1-benzothiophen-3-yl)-2-pyridinyl]-4-[4-(4-hydroxybutoxy)-3-methoxyphenyl]butane-1,4-dione (PubChem CID 149021673) has the molecular formula C28H26FNO5S and a molecular weight of 507.58 g/mol. Its IUPAC name is 1-[6-(7-fluoro-1-benzothiophen-3-yl)-2-pyridinyl]-4-[4-(4-hydroxybutoxy)-3-methoxyphenyl]butane-1,4-dione.
| Compound Name | 1-[6-(7-fluoro-1-benzothiophen-3-yl)-2-pyridinyl]-4-[4-(4-hydroxybutoxy)-3-methoxyphenyl]butane-1,4-dione |
|---|---|
| PubChem CID | 149021673 |
| Molecular Formula | C28H26FNO5S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 1-[6-(7-fluoro-1-benzothiophen-3-yl)-2-pyridinyl]-4-[4-(4-hydroxybutoxy)-3-methoxyphenyl]butane-1,4-dione |
| SMILES | COc1cc(C(=O)CCC(=O)c2cccc(-c3csc4c(F)cccc34)n2)ccc1OCCCCO |
| InChI | InChI=1S/C28H26FNO5S/c1-34-27-16-18(10-13-26(27)35-15-3-2-14-31)24(32)11-12-25(33)23-9-5-8-22(30-23)20-17-36-28-19(20)6-4-7-21(28)29/h4-10,13,16-17,31H,2-3,11-12,14-15H2,1H3 |
| InChIKey | QDOZUTBDBPBZGZ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|