About 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate
2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate (PubChem CID 14902552) has the molecular formula C12H19NO5
and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate |
| PubChem CID | 14902552 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1C(=O)N[C@@H](C(=O)OC(C)(C)C)C1C |
| InChI | InChI=1S/C12H19NO5/c1-6-7(10(15)17-5)9(14)13-8(6)11(16)18-12(2,3)4/h6-8H,1-5H3,(H,13,14)/t6?,7-,8-/m1/s1 |
| InChIKey | HIKGJOSJKKCFSL-SPDVFEMOSA-N |
| XLogP | 0.25 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate?
The IUPAC name of 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate (CID 14902552) is 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate.
What is the SMILES notation for 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate?
The canonical SMILES for 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate is COC(=O)[C@H]1C(=O)N[C@@H](C(=O)OC(C)(C)C)C1C.
What is the InChIKey of 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate?
The InChIKey is HIKGJOSJKKCFSL-SPDVFEMOSA-N. The full InChI is InChI=1S/C12H19NO5/c1-6-7(10(15)17-5)9(14)13-8(6)11(16)18-12(2,3)4/h6-8H,1-5H3,(H,13,14)/t6?,7-,8-/m1/s1.
What are the key properties of 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate?
2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate has a molecular weight of 257.29 g/mol, XLogP of 0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-tert-butyl 4-O-methyl (2R,4R)-3-methyl-5-oxopyrrolidine-2,4-dicarboxylate is sourced from PubChem (CID 14902552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).