C13H21NO5 — CID 14902553
2-O-tert-butyl 4-O-methyl (2R,3R,4R)-3-ethyl-5-oxopyrrolidine-2,4-dicarboxylate (PubChem CID 14902553) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-O-tert-butyl 4-O-methyl (2R,3R,4R)-3-ethyl-5-oxopyrrolidine-2,4-dicarboxylate.
| Compound Name | 2-O-tert-butyl 4-O-methyl (2R,3R,4R)-3-ethyl-5-oxopyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 14902553 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-O-tert-butyl 4-O-methyl (2R,3R,4R)-3-ethyl-5-oxopyrrolidine-2,4-dicarboxylate |
| SMILES | CC[C@@H]1[C@@H](C(=O)OC)C(=O)N[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21NO5/c1-6-7-8(11(16)18-5)10(15)14-9(7)12(17)19-13(2,3)4/h7-9H,6H2,1-5H3,(H,14,15)/t7-,8-,9-/m1/s1 |
| InChIKey | SWUGEKTUVDGXSN-IWSPIJDZSA-N |
| XLogP | 0.64 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|