C20H26O5 — CID 14902655
5-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 14902655) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is 5-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 14902655 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 5-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)C(=O)O1 |
| InChI | InChI=1S/C20H26O5/c1-18(2,3)12-9-11(10-13(15(12)21)19(4,5)6)14-16(22)24-20(7,8)25-17(14)23/h9-10H,1-8H3 |
| InChIKey | MMLLGZGZAQCFNX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|