C9H17N3 — CID 149027435
3,5,6-trimethyl-2,4,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine (PubChem CID 149027435) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 3,5,6-trimethyl-2,4,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine.
| Compound Name | 3,5,6-trimethyl-2,4,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 149027435 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 3,5,6-trimethyl-2,4,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine |
| SMILES | CC1CC2=C(CN1C)N(C)CN2 |
| InChI | InChI=1S/C9H17N3/c1-7-4-8-9(5-11(7)2)12(3)6-10-8/h7,10H,4-6H2,1-3H3 |
| InChIKey | QERJUGWXQWCRAJ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |