4-ethylcyclohexane-1-carboxylic acid

C9H16O2 — CID 1490288

IUPAC4-ethylcyclohexane-1-carboxylic acid
SMILESCCC1CCC(C(=O)O)CC1
InChIInChI=1S/C9H16O2/c1-2-7-3-5-8(6-4-7)9(10)11/h7-8H,2-6H2,1H3,(H,10,11)
InChIKeyUNROFSAOTBVBBT-UHFFFAOYSA-N
MW156.22 g/mol
LogP2.29
Rot. Bonds2

About 4-ethylcyclohexane-1-carboxylic acid

4-ethylcyclohexane-1-carboxylic acid (PubChem CID 1490288) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 4-ethylcyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name4-ethylcyclohexane-1-carboxylic acid
PubChem CID1490288
Molecular FormulaC9H16O2
Molecular Weight156.22 g/mol
Exact Mass156.12
IUPAC Name4-ethylcyclohexane-1-carboxylic acid
SMILESCCC1CCC(C(=O)O)CC1
InChIInChI=1S/C9H16O2/c1-2-7-3-5-8(6-4-7)9(10)11/h7-8H,2-6H2,1H3,(H,10,11)
InChIKeyUNROFSAOTBVBBT-UHFFFAOYSA-N
XLogP2.29
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.22
LogP ≤ 52.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 4-ethylcyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethylcyclohexane-1-carboxylic acid?
The IUPAC name of 4-ethylcyclohexane-1-carboxylic acid (CID 1490288) is 4-ethylcyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-ethylcyclohexane-1-carboxylic acid?
The canonical SMILES for 4-ethylcyclohexane-1-carboxylic acid is CCC1CCC(C(=O)O)CC1.
What is the InChIKey of 4-ethylcyclohexane-1-carboxylic acid?
The InChIKey is UNROFSAOTBVBBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-2-7-3-5-8(6-4-7)9(10)11/h7-8H,2-6H2,1H3,(H,10,11).
What are the key properties of 4-ethylcyclohexane-1-carboxylic acid?
4-ethylcyclohexane-1-carboxylic acid has a molecular weight of 156.22 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylcyclohexane-1-carboxylic acid is sourced from PubChem (CID 1490288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).