C34H43N3O4S — CID 149028883
(2S)-2-[(6-ethyl-1,3-benzothiazol-2-yl)methyl]-N-[(2R)-6-(morpholin-4-ylmethyl)-5-oxo-1-phenylhept-6-en-2-yl]-4-oxohexanamide (PubChem CID 149028883) has the molecular formula C34H43N3O4S and a molecular weight of 589.80 g/mol. Its IUPAC name is (2S)-2-[(6-ethyl-1,3-benzothiazol-2-yl)methyl]-N-[(2R)-6-(morpholin-4-ylmethyl)-5-oxo-1-phenylhept-6-en-2-yl]-4-oxohexanamide.
| Compound Name | (2S)-2-[(6-ethyl-1,3-benzothiazol-2-yl)methyl]-N-[(2R)-6-(morpholin-4-ylmethyl)-5-oxo-1-phenylhept-6-en-2-yl]-4-oxohexanamide |
|---|---|
| PubChem CID | 149028883 |
| Molecular Formula | C34H43N3O4S |
| Molecular Weight | 589.80 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | (2S)-2-[(6-ethyl-1,3-benzothiazol-2-yl)methyl]-N-[(2R)-6-(morpholin-4-ylmethyl)-5-oxo-1-phenylhept-6-en-2-yl]-4-oxohexanamide |
| SMILES | C=C(CN1CCOCC1)C(=O)CC[C@H](Cc1ccccc1)NC(=O)[C@@H](CC(=O)CC)Cc1nc2ccc(CC)cc2s1 |
| InChI | InChI=1S/C34H43N3O4S/c1-4-25-11-13-30-32(20-25)42-33(36-30)22-27(21-29(38)5-2)34(40)35-28(19-26-9-7-6-8-10-26)12-14-31(39)24(3)23-37-15-17-41-18-16-37/h6-11,13,20,27-28H,3-5,12,14-19,21-23H2,1-2H3,(H,35,40)/t27-,28+/m0/s1 |
| InChIKey | QEYLDBRVWJOXHA-WUFINQPMSA-N |
| XLogP | 5.35 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.80 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|