C12H16N2O2 — CID 149030219
ethyl 2-hydrazinyl-1,3-dihydroindene-2-carboxylate (PubChem CID 149030219) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is ethyl 2-hydrazinyl-1,3-dihydroindene-2-carboxylate.
| Compound Name | ethyl 2-hydrazinyl-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 149030219 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | ethyl 2-hydrazinyl-1,3-dihydroindene-2-carboxylate |
| SMILES | CCOC(=O)C1(NN)Cc2ccccc2C1 |
| InChI | InChI=1S/C12H16N2O2/c1-2-16-11(15)12(14-13)7-9-5-3-4-6-10(9)8-12/h3-6,14H,2,7-8,13H2,1H3 |
| InChIKey | QFHIWELSGBTYQX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|