C14H21N — CID 14903383
2-methyl-3,4,5,6,7,8-hexahydro-1H-2-benzazecine (PubChem CID 14903383) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-methyl-3,4,5,6,7,8-hexahydro-1H-2-benzazecine.
| Compound Name | 2-methyl-3,4,5,6,7,8-hexahydro-1H-2-benzazecine |
|---|---|
| PubChem CID | 14903383 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-methyl-3,4,5,6,7,8-hexahydro-1H-2-benzazecine |
| SMILES | CN1CCCCCCc2ccccc2C1 |
| InChI | InChI=1S/C14H21N/c1-15-11-7-3-2-4-8-13-9-5-6-10-14(13)12-15/h5-6,9-10H,2-4,7-8,11-12H2,1H3 |
| InChIKey | NMVVFINEDSAXPQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |