C27H23F6NO2 — CID 149037518
[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]-phenylmethanone (PubChem CID 149037518) has the molecular formula C27H23F6NO2 and a molecular weight of 507.47 g/mol. Its IUPAC name is [(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]-phenylmethanone.
| Compound Name | [(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 149037518 |
| Molecular Formula | C27H23F6NO2 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | [(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]-phenylmethanone |
| SMILES | C[C@]1(c2ccccc2)CN(C(=O)c2ccccc2)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H23F6NO2/c1-24(20-10-6-3-7-11-20)17-34(23(35)19-8-4-2-5-9-19)16-22(24)18-12-14-21(15-13-18)25(36,26(28,29)30)27(31,32)33/h2-15,22,36H,16-17H2,1H3/t22-,24+/m0/s1 |
| InChIKey | QGXLQHDKLPYLDY-LADGPHEKSA-N |
| XLogP | 6.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |