C12H20ClN2O3PS2 — CID 149043261
(4R)-6-chloro-N-ethyl-2-(3-methoxypropyl)-1,1-dioxo-N-phosphanyl-3,4-dihydrothieno[3,2-e]thiazin-4-amine (PubChem CID 149043261) has the molecular formula C12H20ClN2O3PS2 and a molecular weight of 370.86 g/mol. Its IUPAC name is (4R)-6-chloro-N-ethyl-2-(3-methoxypropyl)-1,1-dioxo-N-phosphanyl-3,4-dihydrothieno[3,2-e]thiazin-4-amine.
| Compound Name | (4R)-6-chloro-N-ethyl-2-(3-methoxypropyl)-1,1-dioxo-N-phosphanyl-3,4-dihydrothieno[3,2-e]thiazin-4-amine |
|---|---|
| PubChem CID | 149043261 |
| Molecular Formula | C12H20ClN2O3PS2 |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | (4R)-6-chloro-N-ethyl-2-(3-methoxypropyl)-1,1-dioxo-N-phosphanyl-3,4-dihydrothieno[3,2-e]thiazin-4-amine |
| SMILES | CCN(P)[C@H]1CN(CCCOC)S(=O)(=O)c2sc(Cl)cc21 |
| InChI | InChI=1S/C12H20ClN2O3PS2/c1-3-15(19)10-8-14(5-4-6-18-2)21(16,17)12-9(10)7-11(13)20-12/h7,10H,3-6,8,19H2,1-2H3/t10-/m0/s1 |
| InChIKey | QHZYXIZUBNZSKX-JTQLQIEISA-N |
| XLogP | 2.60 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|